C28H54O3Si3 — CID 91748443
[(3R,5R,10S,11S,13S)-10,13-dimethyl-3,11-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane (PubChem CID 91748443) has the molecular formula C28H54O3Si3 and a molecular weight of 523.00 g/mol. Its IUPAC name is [(3R,5R,10S,11S,13S)-10,13-dimethyl-3,11-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane.
| Compound Name | [(3R,5R,10S,11S,13S)-10,13-dimethyl-3,11-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 91748443 |
| Molecular Formula | C28H54O3Si3 |
| Molecular Weight | 523.00 g/mol |
| Exact Mass | 522.34 |
| IUPAC Name | [(3R,5R,10S,11S,13S)-10,13-dimethyl-3,11-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
| SMILES | C[C@]12CC(O[Si](C)(C)C)C3C(CC[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]34C)C1CC=C2O[Si](C)(C)C |
| InChI | InChI=1S/C28H54O3Si3/c1-27-17-16-21(29-32(3,4)5)18-20(27)12-13-22-23-14-15-25(31-34(9,10)11)28(23,2)19-24(26(22)27)30-33(6,7)8/h15,20-24,26H,12-14,16-19H2,1-11H3/t20-,21-,22?,23?,24?,26?,27+,28+/m1/s1 |
| InChIKey | HTALMMXGRYNYNV-HMCUICTISA-N |
| XLogP | 8.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.00 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|