About 3-methylsulfanylhexyl propanoate
3-methylsulfanylhexyl propanoate (PubChem CID 91748563) has the molecular formula C10H20O2S
and a molecular weight of 204.33 g/mol. Its IUPAC name is 3-methylsulfanylhexyl propanoate.
Molecular Properties
| Compound Name | 3-methylsulfanylhexyl propanoate |
| PubChem CID | 91748563 |
| Molecular Formula | C10H20O2S |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 3-methylsulfanylhexyl propanoate |
| SMILES | CCCC(CCOC(=O)CC)SC |
| InChI | InChI=1S/C10H20O2S/c1-4-6-9(13-3)7-8-12-10(11)5-2/h9H,4-8H2,1-3H3 |
| InChIKey | LRZFIJCVXUBBRY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylsulfanylhexyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfanylhexyl propanoate?
The IUPAC name of 3-methylsulfanylhexyl propanoate (CID 91748563) is 3-methylsulfanylhexyl propanoate.
What is the SMILES notation for 3-methylsulfanylhexyl propanoate?
The canonical SMILES for 3-methylsulfanylhexyl propanoate is CCCC(CCOC(=O)CC)SC.
What is the InChIKey of 3-methylsulfanylhexyl propanoate?
The InChIKey is LRZFIJCVXUBBRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2S/c1-4-6-9(13-3)7-8-12-10(11)5-2/h9H,4-8H2,1-3H3.
What are the key properties of 3-methylsulfanylhexyl propanoate?
3-methylsulfanylhexyl propanoate has a molecular weight of 204.33 g/mol, XLogP of 2.86, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfanylhexyl propanoate is sourced from PubChem (CID 91748563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).