About 5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane
5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane (PubChem CID 91748591) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is 5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane.
Molecular Properties
| Compound Name | 5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane |
| PubChem CID | 91748591 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane |
| SMILES | C=CC1(C)CCC(C(C)C2CCC(C)(C)O2)O1 |
| InChI | InChI=1S/C15H26O2/c1-6-15(5)10-8-13(17-15)11(2)12-7-9-14(3,4)16-12/h6,11-13H,1,7-10H2,2-5H3 |
| InChIKey | MWVSMYWOHUWFCW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane?
The IUPAC name of 5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane (CID 91748591) is 5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane.
What is the SMILES notation for 5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane?
The canonical SMILES for 5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane is C=CC1(C)CCC(C(C)C2CCC(C)(C)O2)O1.
What is the InChIKey of 5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane?
The InChIKey is MWVSMYWOHUWFCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2/c1-6-15(5)10-8-13(17-15)11(2)12-7-9-14(3,4)16-12/h6,11-13H,1,7-10H2,2-5H3.
What are the key properties of 5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane?
5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane has a molecular weight of 238.37 g/mol, XLogP of 3.70, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(5,5-dimethyloxolan-2-yl)ethyl]-2-ethenyl-2-methyloxolane is sourced from PubChem (CID 91748591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).