About 4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one
4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one (PubChem CID 91748727) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one.
Molecular Properties
| Compound Name | 4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one |
| PubChem CID | 91748727 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one |
| SMILES | CC(=O)CCC1C(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C13H24O2/c1-9-7-11(15)8-13(3,4)12(9)6-5-10(2)14/h9,11-12,15H,5-8H2,1-4H3 |
| InChIKey | GZFXCGAUFAQBLT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one?
The IUPAC name of 4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one (CID 91748727) is 4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one.
What is the SMILES notation for 4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one?
The canonical SMILES for 4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one is CC(=O)CCC1C(C)CC(O)CC1(C)C.
What is the InChIKey of 4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one?
The InChIKey is GZFXCGAUFAQBLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-9-7-11(15)8-13(3,4)12(9)6-5-10(2)14/h9,11-12,15H,5-8H2,1-4H3.
What are the key properties of 4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one?
4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one has a molecular weight of 212.33 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-one is sourced from PubChem (CID 91748727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).