C15H24O — CID 91748783
(2Z)-2-[(3E,7Z)-4,8-dimethylcyclodeca-3,7-dien-1-ylidene]propan-1-ol (PubChem CID 91748783) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (2Z)-2-[(3E,7Z)-4,8-dimethylcyclodeca-3,7-dien-1-ylidene]propan-1-ol.
| Compound Name | (2Z)-2-[(3E,7Z)-4,8-dimethylcyclodeca-3,7-dien-1-ylidene]propan-1-ol |
|---|---|
| PubChem CID | 91748783 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (2Z)-2-[(3E,7Z)-4,8-dimethylcyclodeca-3,7-dien-1-ylidene]propan-1-ol |
| SMILES | C/C1=C/CC/C(C)=C/C/C(=C(/C)CO)CC1 |
| InChI | InChI=1S/C15H24O/c1-12-5-4-6-13(2)8-10-15(9-7-12)14(3)11-16/h5,8,16H,4,6-7,9-11H2,1-3H3/b12-5-,13-8+,15-14- |
| InChIKey | JEPRHCQQNHNKJV-LGBFMXSASA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|