C16H21F7O6 — CID 91748921
bis(2-methylpropyl) 2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)butanedioate (PubChem CID 91748921) has the molecular formula C16H21F7O6 and a molecular weight of 442.32 g/mol. Its IUPAC name is bis(2-methylpropyl) 2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)butanedioate.
| Compound Name | bis(2-methylpropyl) 2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)butanedioate |
|---|---|
| PubChem CID | 91748921 |
| Molecular Formula | C16H21F7O6 |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | bis(2-methylpropyl) 2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)butanedioate |
| SMILES | CC(C)COC(=O)CC(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCC(C)C |
| InChI | InChI=1S/C16H21F7O6/c1-8(2)6-27-11(24)5-10(12(25)28-7-9(3)4)29-13(26)14(17,18)15(19,20)16(21,22)23/h8-10H,5-7H2,1-4H3 |
| InChIKey | COWQMXIGJDIPSD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|