C20H14F14O6 — CID 91748922
[4-[1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-2-(2-methylpropoxy)-2-oxoethyl]phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91748922) has the molecular formula C20H14F14O6 and a molecular weight of 616.30 g/mol. Its IUPAC name is [4-[1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-2-(2-methylpropoxy)-2-oxoethyl]phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [4-[1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-2-(2-methylpropoxy)-2-oxoethyl]phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91748922 |
| Molecular Formula | C20H14F14O6 |
| Molecular Weight | 616.30 g/mol |
| Exact Mass | 616.06 |
| IUPAC Name | [4-[1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-2-(2-methylpropoxy)-2-oxoethyl]phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CC(C)COC(=O)C(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H14F14O6/c1-8(2)7-38-12(35)11(40-14(37)16(23,24)18(27,28)20(32,33)34)9-3-5-10(6-4-9)39-13(36)15(21,22)17(25,26)19(29,30)31/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | BEKLUQATPGSDMB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.30 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|