C12H11F3O4 — CID 91749157
methyl 3-[4-(2,2,2-trifluoroacetyl)oxyphenyl]propanoate (PubChem CID 91749157) has the molecular formula C12H11F3O4 and a molecular weight of 276.21 g/mol. Its IUPAC name is methyl 3-[4-(2,2,2-trifluoroacetyl)oxyphenyl]propanoate.
| Compound Name | methyl 3-[4-(2,2,2-trifluoroacetyl)oxyphenyl]propanoate |
|---|---|
| PubChem CID | 91749157 |
| Molecular Formula | C12H11F3O4 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | methyl 3-[4-(2,2,2-trifluoroacetyl)oxyphenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F3O4/c1-18-10(16)7-4-8-2-5-9(6-3-8)19-11(17)12(13,14)15/h2-3,5-6H,4,7H2,1H3 |
| InChIKey | LYFORWVQNRLTOQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|