C34H64O5Si3 — CID 91749245
methyl (4R)-4-[(3S,7R,10R,12S,13R,17R)-10,13-dimethyl-3,7,12-tris(trimethylsilyloxy)-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 91749245) has the molecular formula C34H64O5Si3 and a molecular weight of 637.14 g/mol. Its IUPAC name is methyl (4R)-4-[(3S,7R,10R,12S,13R,17R)-10,13-dimethyl-3,7,12-tris(trimethylsilyloxy)-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3S,7R,10R,12S,13R,17R)-10,13-dimethyl-3,7,12-tris(trimethylsilyloxy)-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 91749245 |
| Molecular Formula | C34H64O5Si3 |
| Molecular Weight | 637.14 g/mol |
| Exact Mass | 636.41 |
| IUPAC Name | methyl (4R)-4-[(3S,7R,10R,12S,13R,17R)-10,13-dimethyl-3,7,12-tris(trimethylsilyloxy)-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CCC2C3C(O[Si](C)(C)C)CC4=C[C@@H](O[Si](C)(C)C)CC[C@]4(C)C3C[C@H](O[Si](C)(C)C)[C@@]21C |
| InChI | InChI=1S/C34H64O5Si3/c1-23(14-17-31(35)36-4)26-15-16-27-32-28(22-30(34(26,27)3)39-42(11,12)13)33(2)19-18-25(37-40(5,6)7)20-24(33)21-29(32)38-41(8,9)10/h20,23,25-30,32H,14-19,21-22H2,1-13H3/t23-,25+,26-,27?,28?,29?,30+,32?,33+,34-/m1/s1 |
| InChIKey | QVMBQRVPUGQSMQ-LFWRYPSUSA-N |
| XLogP | 9.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.14 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|