C29H50OSi — CID 91749267
trimethyl-[[(3S,13R,17R)-13-methyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]silane (PubChem CID 91749267) has the molecular formula C29H50OSi and a molecular weight of 442.80 g/mol. Its IUPAC name is trimethyl-[[(3S,13R,17R)-13-methyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]silane.
| Compound Name | trimethyl-[[(3S,13R,17R)-13-methyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]silane |
|---|---|
| PubChem CID | 91749267 |
| Molecular Formula | C29H50OSi |
| Molecular Weight | 442.80 g/mol |
| Exact Mass | 442.36 |
| IUPAC Name | trimethyl-[[(3S,13R,17R)-13-methyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]silane |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3=C(CC[C@@]21C)C1CC[C@H](O[Si](C)(C)C)CC1=CC3 |
| InChI | InChI=1S/C29H50OSi/c1-20(2)9-8-10-21(3)27-15-16-28-26-13-11-22-19-23(30-31(5,6)7)12-14-24(22)25(26)17-18-29(27,28)4/h11,20-21,23-24,27-28H,8-10,12-19H2,1-7H3/t21-,23+,24?,27-,28?,29-/m1/s1 |
| InChIKey | IQCMAKKNYXVJGX-CWYKHXMSSA-N |
| XLogP | 8.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.80 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|