About 2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate
2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate (PubChem CID 91749293) has the molecular formula C19H33NO3Si
and a molecular weight of 351.56 g/mol. Its IUPAC name is 2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate |
| PubChem CID | 91749293 |
| Molecular Formula | C19H33NO3Si |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate |
| SMILES | CC(C)COC(=O)NCC(O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H33NO3Si/c1-15(2)14-22-18(21)20-13-17(16-11-9-8-10-12-16)23-24(6,7)19(3,4)5/h8-12,15,17H,13-14H2,1-7H3,(H,20,21) |
| InChIKey | SUDNYVLMMNDTSR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate?
The IUPAC name of 2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate (CID 91749293) is 2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate.
What is the SMILES notation for 2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate?
The canonical SMILES for 2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate is CC(C)COC(=O)NCC(O[Si](C)(C)C(C)(C)C)c1ccccc1.
What is the InChIKey of 2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate?
The InChIKey is SUDNYVLMMNDTSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33NO3Si/c1-15(2)14-22-18(21)20-13-17(16-11-9-8-10-12-16)23-24(6,7)19(3,4)5/h8-12,15,17H,13-14H2,1-7H3,(H,20,21).
What are the key properties of 2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate?
2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate has a molecular weight of 351.56 g/mol, XLogP of 5.13, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]carbamate is sourced from PubChem (CID 91749293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).