C24H26F12O10 — CID 91749415
[(2S,3S,4R,5S,6S)-6-[(3S)-3,7-dimethyloct-6-enoxy]-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate (PubChem CID 91749415) has the molecular formula C24H26F12O10 and a molecular weight of 702.44 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6S)-6-[(3S)-3,7-dimethyloct-6-enoxy]-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [(2S,3S,4R,5S,6S)-6-[(3S)-3,7-dimethyloct-6-enoxy]-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91749415 |
| Molecular Formula | C24H26F12O10 |
| Molecular Weight | 702.44 g/mol |
| Exact Mass | 702.13 |
| IUPAC Name | [(2S,3S,4R,5S,6S)-6-[(3S)-3,7-dimethyloct-6-enoxy]-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate |
| SMILES | CC(C)=CCC[C@H](C)CCO[C@H]1O[C@@H](COC(=O)C(F)(F)F)[C@H](OC(=O)C(F)(F)F)[C@@H](OC(=O)C(F)(F)F)[C@@H]1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C24H26F12O10/c1-10(2)5-4-6-11(3)7-8-41-16-15(46-20(40)24(34,35)36)14(45-19(39)23(31,32)33)13(44-18(38)22(28,29)30)12(43-16)9-42-17(37)21(25,26)27/h5,11-16H,4,6-9H2,1-3H3/t11-,12-,13-,14+,15-,16-/m0/s1 |
| InChIKey | ZJAHYNJNLFTXKW-CMXYNOPPSA-N |
| XLogP | 5.03 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|