C24H24F12O10 — CID 91749418
[(2S,3S,4R,5S,6R)-6-(3,7-dimethylocta-1,6-dien-3-yloxy)-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate (PubChem CID 91749418) has the molecular formula C24H24F12O10 and a molecular weight of 700.42 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-6-(3,7-dimethylocta-1,6-dien-3-yloxy)-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [(2S,3S,4R,5S,6R)-6-(3,7-dimethylocta-1,6-dien-3-yloxy)-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91749418 |
| Molecular Formula | C24H24F12O10 |
| Molecular Weight | 700.42 g/mol |
| Exact Mass | 700.12 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-6-(3,7-dimethylocta-1,6-dien-3-yloxy)-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2,2,2-trifluoroacetate |
| SMILES | C=CC(C)(CCC=C(C)C)O[C@H]1O[C@@H](COC(=O)C(F)(F)F)[C@H](OC(=O)C(F)(F)F)[C@@H](OC(=O)C(F)(F)F)[C@@H]1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C24H24F12O10/c1-5-20(4,8-6-7-10(2)3)46-15-14(45-19(40)24(34,35)36)13(44-18(39)23(31,32)33)12(43-17(38)22(28,29)30)11(42-15)9-41-16(37)21(25,26)27/h5,7,11-15H,1,6,8-9H2,2-4H3/t11-,12-,13+,14-,15+,20?/m0/s1 |
| InChIKey | PXNCKBQISHIDRF-DRFXTBLLSA-N |
| XLogP | 4.95 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|