C10H17NO3 — CID 91749425
[(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl acetate (PubChem CID 91749425) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is [(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl acetate.
| Compound Name | [(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl acetate |
|---|---|
| PubChem CID | 91749425 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | [(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CCN2CC[C@@H](O)C12 |
| InChI | InChI=1S/C10H17NO3/c1-7(12)14-6-8-2-4-11-5-3-9(13)10(8)11/h8-10,13H,2-6H2,1H3/t8-,9-,10?/m1/s1 |
| InChIKey | WUMANOURGAZXKZ-MGRQHWMJSA-N |
| XLogP | 0.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |