C12H21NO3 — CID 91749437
[(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl butanoate (PubChem CID 91749437) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is [(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl butanoate.
| Compound Name | [(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl butanoate |
|---|---|
| PubChem CID | 91749437 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | [(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1CCN2CC[C@@H](O)C12 |
| InChI | InChI=1S/C12H21NO3/c1-2-3-11(15)16-8-9-4-6-13-7-5-10(14)12(9)13/h9-10,12,14H,2-8H2,1H3/t9-,10-,12?/m1/s1 |
| InChIKey | XHOXLWVKPKHLFN-UVTZGIPTSA-N |
| XLogP | 0.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |