C18H31NO6 — CID 91749438
[(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (2S,3S)-2-hydroxy-2-methyl-3-(2-methylbutanoyloxy)butanoate (PubChem CID 91749438) has the molecular formula C18H31NO6 and a molecular weight of 357.45 g/mol. Its IUPAC name is [(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (2S,3S)-2-hydroxy-2-methyl-3-(2-methylbutanoyloxy)butanoate.
| Compound Name | [(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (2S,3S)-2-hydroxy-2-methyl-3-(2-methylbutanoyloxy)butanoate |
|---|---|
| PubChem CID | 91749438 |
| Molecular Formula | C18H31NO6 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | [(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (2S,3S)-2-hydroxy-2-methyl-3-(2-methylbutanoyloxy)butanoate |
| SMILES | CCC(C)C(=O)O[C@@H](C)[C@](C)(O)C(=O)OC[C@H]1CCN2CC[C@@H](O)C12 |
| InChI | InChI=1S/C18H31NO6/c1-5-11(2)16(21)25-12(3)18(4,23)17(22)24-10-13-6-8-19-9-7-14(20)15(13)19/h11-15,20,23H,5-10H2,1-4H3/t11?,12-,13+,14+,15?,18-/m0/s1 |
| InChIKey | QGMFKSHYVNTQIZ-WUPNXCOWSA-N |
| XLogP | 0.71 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |