C23H40OSi — CID 91749485
[(1S,5R,9S)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methoxy-trimethylsilane (PubChem CID 91749485) has the molecular formula C23H40OSi and a molecular weight of 360.66 g/mol. Its IUPAC name is [(1S,5R,9S)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methoxy-trimethylsilane.
| Compound Name | [(1S,5R,9S)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methoxy-trimethylsilane |
|---|---|
| PubChem CID | 91749485 |
| Molecular Formula | C23H40OSi |
| Molecular Weight | 360.66 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | [(1S,5R,9S)-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methoxy-trimethylsilane |
| SMILES | C=C1C[C@@]23CCC4[C@](C)(CO[Si](C)(C)C)CCC[C@@]4(C)C2CCC1C3 |
| InChI | InChI=1S/C23H40OSi/c1-17-14-23-13-10-19-21(2,16-24-25(4,5)6)11-7-12-22(19,3)20(23)9-8-18(17)15-23/h18-20H,1,7-16H2,2-6H3/t18?,19?,20?,21-,22+,23+/m0/s1 |
| InChIKey | ROUGQYHITZRPPQ-DSJBWLRPSA-N |
| XLogP | 6.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.66 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|