C22H52O6Si4 — CID 91749493
(2S,3S,4S,5S)-2-butoxy-3,4,5,6-tetrakis(trimethylsilyloxy)hexanal (PubChem CID 91749493) has the molecular formula C22H52O6Si4 and a molecular weight of 525.00 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2-butoxy-3,4,5,6-tetrakis(trimethylsilyloxy)hexanal.
| Compound Name | (2S,3S,4S,5S)-2-butoxy-3,4,5,6-tetrakis(trimethylsilyloxy)hexanal |
|---|---|
| PubChem CID | 91749493 |
| Molecular Formula | C22H52O6Si4 |
| Molecular Weight | 525.00 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | (2S,3S,4S,5S)-2-butoxy-3,4,5,6-tetrakis(trimethylsilyloxy)hexanal |
| SMILES | CCCCO[C@H](C=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C22H52O6Si4/c1-14-15-16-24-19(17-23)21(27-31(8,9)10)22(28-32(11,12)13)20(26-30(5,6)7)18-25-29(2,3)4/h17,19-22H,14-16,18H2,1-13H3/t19-,20+,21+,22+/m1/s1 |
| InChIKey | HWFPIBHRTLDTCF-MLNNCEHLSA-N |
| XLogP | 5.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.00 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|