C34H62O4Si2 — CID 91749499
methyl (6R)-6-[(7R,10R,12S,13R,17R)-10,13-dimethyl-7,12-bis(trimethylsilyloxy)-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoate (PubChem CID 91749499) has the molecular formula C34H62O4Si2 and a molecular weight of 591.04 g/mol. Its IUPAC name is methyl (6R)-6-[(7R,10R,12S,13R,17R)-10,13-dimethyl-7,12-bis(trimethylsilyloxy)-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoate.
| Compound Name | methyl (6R)-6-[(7R,10R,12S,13R,17R)-10,13-dimethyl-7,12-bis(trimethylsilyloxy)-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoate |
|---|---|
| PubChem CID | 91749499 |
| Molecular Formula | C34H62O4Si2 |
| Molecular Weight | 591.04 g/mol |
| Exact Mass | 590.42 |
| IUPAC Name | methyl (6R)-6-[(7R,10R,12S,13R,17R)-10,13-dimethyl-7,12-bis(trimethylsilyloxy)-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoate |
| SMILES | COC(=O)C(C)CCC[C@@H](C)[C@H]1CCC2C3C(O[Si](C)(C)C)CC4=CCCC[C@]4(C)C3C[C@H](O[Si](C)(C)C)[C@@]21C |
| InChI | InChI=1S/C34H62O4Si2/c1-23(15-14-16-24(2)32(35)36-5)26-18-19-27-31-28(22-30(34(26,27)4)38-40(9,10)11)33(3)20-13-12-17-25(33)21-29(31)37-39(6,7)8/h17,23-24,26-31H,12-16,18-22H2,1-11H3/t23-,24?,26-,27?,28?,29?,30+,31?,33+,34-/m1/s1 |
| InChIKey | WGNLRMKQRYFUJN-DIDRKBJVSA-N |
| XLogP | 9.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.04 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|