About methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate
methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate (PubChem CID 91749550) has the molecular formula C28H60O5Si3
and a molecular weight of 561.04 g/mol. Its IUPAC name is methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate.
Molecular Properties
| Compound Name | methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate |
| PubChem CID | 91749550 |
| Molecular Formula | C28H60O5Si3 |
| Molecular Weight | 561.04 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate |
| SMILES | CCCCCC(O[Si](C)(C)C)C(/C=C\C(CCCCCCCC(=O)OC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C28H60O5Si3/c1-12-13-17-21-26(32-35(6,7)8)27(33-36(9,10)11)24-23-25(31-34(3,4)5)20-18-15-14-16-19-22-28(29)30-2/h23-27H,12-22H2,1-11H3/b24-23- |
| InChIKey | CXCODGVCNLKQLF-VHXPQNKSSA-N |
| XLogP | 8.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.04 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate?
The IUPAC name of methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate (CID 91749550) is methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate.
What is the SMILES notation for methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate?
The canonical SMILES for methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate is CCCCCC(O[Si](C)(C)C)C(/C=C\C(CCCCCCCC(=O)OC)O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate?
The InChIKey is CXCODGVCNLKQLF-VHXPQNKSSA-N. The full InChI is InChI=1S/C28H60O5Si3/c1-12-13-17-21-26(32-35(6,7)8)27(33-36(9,10)11)24-23-25(31-34(3,4)5)20-18-15-14-16-19-22-28(29)30-2/h23-27H,12-22H2,1-11H3/b24-23-.
What are the key properties of methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate?
methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate has a molecular weight of 561.04 g/mol, XLogP of 8.69, 21 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-9,12,13-tris(trimethylsilyloxy)octadec-10-enoate is sourced from PubChem (CID 91749550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).