C15H30N2O3SSi2 — CID 91749598
trimethylsilyl 4-[(3aS,4S,6aR)-2-trimethylsilyloxy-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]butanoate (PubChem CID 91749598) has the molecular formula C15H30N2O3SSi2 and a molecular weight of 374.66 g/mol. Its IUPAC name is trimethylsilyl 4-[(3aS,4S,6aR)-2-trimethylsilyloxy-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]butanoate.
| Compound Name | trimethylsilyl 4-[(3aS,4S,6aR)-2-trimethylsilyloxy-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]butanoate |
|---|---|
| PubChem CID | 91749598 |
| Molecular Formula | C15H30N2O3SSi2 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | trimethylsilyl 4-[(3aS,4S,6aR)-2-trimethylsilyloxy-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]butanoate |
| SMILES | C[Si](C)(C)OC(=O)CCC[C@@H]1SC[C@@H]2NC(O[Si](C)(C)C)=N[C@@H]21 |
| InChI | InChI=1S/C15H30N2O3SSi2/c1-22(2,3)19-13(18)9-7-8-12-14-11(10-21-12)16-15(17-14)20-23(4,5)6/h11-12,14H,7-10H2,1-6H3,(H,16,17)/t11-,12-,14-/m0/s1 |
| InChIKey | VRTYBBSNSFHHIZ-OBJOEFQTSA-N |
| XLogP | 3.20 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|