About (Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal
(Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal (PubChem CID 91749636) has the molecular formula C10H18OS2
and a molecular weight of 218.39 g/mol. Its IUPAC name is (Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal.
Molecular Properties
| Compound Name | (Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal |
| PubChem CID | 91749636 |
| Molecular Formula | C10H18OS2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal |
| SMILES | CC(C)SC/C=C(/C=O)SC(C)C |
| InChI | InChI=1S/C10H18OS2/c1-8(2)12-6-5-10(7-11)13-9(3)4/h5,7-9H,6H2,1-4H3/b10-5- |
| InChIKey | ZDPDFFMZPRJHCR-YHYXMXQVSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal?
The IUPAC name of (Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal (CID 91749636) is (Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal.
What is the SMILES notation for (Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal?
The canonical SMILES for (Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal is CC(C)SC/C=C(/C=O)SC(C)C.
What is the InChIKey of (Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal?
The InChIKey is ZDPDFFMZPRJHCR-YHYXMXQVSA-N. The full InChI is InChI=1S/C10H18OS2/c1-8(2)12-6-5-10(7-11)13-9(3)4/h5,7-9H,6H2,1-4H3/b10-5-.
What are the key properties of (Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal?
(Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal has a molecular weight of 218.39 g/mol, XLogP of 3.35, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,4-bis(propan-2-ylsulfanyl)but-2-enal is sourced from PubChem (CID 91749636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).