C23H31NO6 — CID 91749687
[(1S,4Z,6S,7S)-4-ethylidene-6,7-dimethyl-3,8-dioxo-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-en-7-yl] (Z)-2-methylbut-2-enoate (PubChem CID 91749687) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is [(1S,4Z,6S,7S)-4-ethylidene-6,7-dimethyl-3,8-dioxo-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-en-7-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S,4Z,6S,7S)-4-ethylidene-6,7-dimethyl-3,8-dioxo-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-en-7-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 91749687 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | [(1S,4Z,6S,7S)-4-ethylidene-6,7-dimethyl-3,8-dioxo-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-en-7-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@]1(C)C(=O)OCC2=CCN3CC[C@H](OC(=O)/C(=C\C)C[C@@H]1C)C23 |
| InChI | InChI=1S/C23H31NO6/c1-6-14(3)20(25)30-23(5)15(4)12-16(7-2)21(26)29-18-9-11-24-10-8-17(19(18)24)13-28-22(23)27/h6-8,15,18-19H,9-13H2,1-5H3/b14-6-,16-7-/t15-,18-,19?,23-/m0/s1 |
| InChIKey | MGQIZYQQEVSTTF-RUQDDOQKSA-N |
| XLogP | 2.71 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|