C14H22O — CID 91749733
6-methyl-2-(4-methylcyclohex-3-en-1-yl)-2,3,4,7-tetrahydrooxepine (PubChem CID 91749733) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 6-methyl-2-(4-methylcyclohex-3-en-1-yl)-2,3,4,7-tetrahydrooxepine.
| Compound Name | 6-methyl-2-(4-methylcyclohex-3-en-1-yl)-2,3,4,7-tetrahydrooxepine |
|---|---|
| PubChem CID | 91749733 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 6-methyl-2-(4-methylcyclohex-3-en-1-yl)-2,3,4,7-tetrahydrooxepine |
| SMILES | CC1=CCC(C2CCC=C(C)CO2)CC1 |
| InChI | InChI=1S/C14H22O/c1-11-6-8-13(9-7-11)14-5-3-4-12(2)10-15-14/h4,6,13-14H,3,5,7-10H2,1-2H3 |
| InChIKey | QTWUDCCAKQVTQQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|