C15H22O — CID 91749743
(1S,4R,7R,8R,12R)-3,3,7,11-tetramethyl-2-oxatetracyclo[5.4.1.01,8.04,12]dodec-10-ene (PubChem CID 91749743) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (1S,4R,7R,8R,12R)-3,3,7,11-tetramethyl-2-oxatetracyclo[5.4.1.01,8.04,12]dodec-10-ene.
| Compound Name | (1S,4R,7R,8R,12R)-3,3,7,11-tetramethyl-2-oxatetracyclo[5.4.1.01,8.04,12]dodec-10-ene |
|---|---|
| PubChem CID | 91749743 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (1S,4R,7R,8R,12R)-3,3,7,11-tetramethyl-2-oxatetracyclo[5.4.1.01,8.04,12]dodec-10-ene |
| SMILES | CC1=CC[C@@H]2[C@@]3(C)CC[C@@H]4[C@H]3[C@]12OC4(C)C |
| InChI | InChI=1S/C15H22O/c1-9-5-6-11-14(4)8-7-10-12(14)15(9,11)16-13(10,2)3/h5,10-12H,6-8H2,1-4H3/t10-,11-,12-,14-,15+/m1/s1 |
| InChIKey | MMJLGRDTAHXVGD-FWZIUSJTSA-N |
| XLogP | 3.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|