C15H22O — CID 91749824
(2R,4R,12R)-3,3,7,12-tetramethyl-10-oxatricyclo[6.4.0.02,4]dodeca-6,8-diene (PubChem CID 91749824) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (2R,4R,12R)-3,3,7,12-tetramethyl-10-oxatricyclo[6.4.0.02,4]dodeca-6,8-diene.
| Compound Name | (2R,4R,12R)-3,3,7,12-tetramethyl-10-oxatricyclo[6.4.0.02,4]dodeca-6,8-diene |
|---|---|
| PubChem CID | 91749824 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (2R,4R,12R)-3,3,7,12-tetramethyl-10-oxatricyclo[6.4.0.02,4]dodeca-6,8-diene |
| SMILES | CC1=CC[C@@H]2[C@H](C3C1=COC[C@@H]3C)C2(C)C |
| InChI | InChI=1S/C15H22O/c1-9-5-6-12-14(15(12,3)4)13-10(2)7-16-8-11(9)13/h5,8,10,12-14H,6-7H2,1-4H3/t10-,12+,13?,14+/m0/s1 |
| InChIKey | PEDRFNLMEGPQLB-HTSACEBVSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |