About 1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea
1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea (PubChem CID 917499) has the molecular formula C17H17N3OS
and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea.
Molecular Properties
| Compound Name | 1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea |
| PubChem CID | 917499 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N(Cc1ccccc1)C1=NCCS1 |
| InChI | InChI=1S/C17H17N3OS/c21-16(19-15-9-5-2-6-10-15)20(17-18-11-12-22-17)13-14-7-3-1-4-8-14/h1-10H,11-13H2,(H,19,21) |
| InChIKey | RJEFUGUAZORYQC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea?
The IUPAC name of 1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea (CID 917499) is 1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea.
What is the SMILES notation for 1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea?
The canonical SMILES for 1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea is O=C(Nc1ccccc1)N(Cc1ccccc1)C1=NCCS1.
What is the InChIKey of 1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea?
The InChIKey is RJEFUGUAZORYQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3OS/c21-16(19-15-9-5-2-6-10-15)20(17-18-11-12-22-17)13-14-7-3-1-4-8-14/h1-10H,11-13H2,(H,19,21).
What are the key properties of 1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea?
1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea has a molecular weight of 311.41 g/mol, XLogP of 3.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-1-(4,5-dihydro-1,3-thiazol-2-yl)-3-phenylurea is sourced from PubChem (CID 917499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).