C18H29NO5 — CID 91749900
[(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (2S,3R)-2-hydroxy-2-methyl-3-[(E)-2-methylbut-2-enoyl]oxybutanoate (PubChem CID 91749900) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is [(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (2S,3R)-2-hydroxy-2-methyl-3-[(E)-2-methylbut-2-enoyl]oxybutanoate.
| Compound Name | [(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (2S,3R)-2-hydroxy-2-methyl-3-[(E)-2-methylbut-2-enoyl]oxybutanoate |
|---|---|
| PubChem CID | 91749900 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | [(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (2S,3R)-2-hydroxy-2-methyl-3-[(E)-2-methylbut-2-enoyl]oxybutanoate |
| SMILES | C/C=C(\C)C(=O)O[C@H](C)[C@](C)(O)C(=O)OC[C@@H]1CCN2CCC[C@@H]12 |
| InChI | InChI=1S/C18H29NO5/c1-5-12(2)16(20)24-13(3)18(4,22)17(21)23-11-14-8-10-19-9-6-7-15(14)19/h5,13-15,22H,6-11H2,1-4H3/b12-5+/t13-,14+,15+,18+/m1/s1 |
| InChIKey | QWLVLKBPONBFQZ-BPIFGQDUSA-N |
| XLogP | 1.66 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|