C28H66O9Si6 — CID 91749915
(2R,3S,4R)-2,3,5-tris(trimethylsilyloxy)-4-[(2S,3R,4S,5R)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]oxypentanal (PubChem CID 91749915) has the molecular formula C28H66O9Si6 and a molecular weight of 715.34 g/mol. Its IUPAC name is (2R,3S,4R)-2,3,5-tris(trimethylsilyloxy)-4-[(2S,3R,4S,5R)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]oxypentanal.
| Compound Name | (2R,3S,4R)-2,3,5-tris(trimethylsilyloxy)-4-[(2S,3R,4S,5R)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]oxypentanal |
|---|---|
| PubChem CID | 91749915 |
| Molecular Formula | C28H66O9Si6 |
| Molecular Weight | 715.34 g/mol |
| Exact Mass | 714.33 |
| IUPAC Name | (2R,3S,4R)-2,3,5-tris(trimethylsilyloxy)-4-[(2S,3R,4S,5R)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]oxypentanal |
| SMILES | C[Si](C)(C)OC[C@@H](O[C@@H]1OC[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](C=O)O[Si](C)(C)C |
| InChI | InChI=1S/C28H66O9Si6/c1-38(2,3)31-21-23(25(35-41(10,11)12)22(19-29)33-39(4,5)6)32-28-27(37-43(16,17)18)26(36-42(13,14)15)24(20-30-28)34-40(7,8)9/h19,22-28H,20-21H2,1-18H3/t22-,23+,24+,25+,26-,27+,28-/m0/s1 |
| InChIKey | FNKUSCCBLBUZFF-WOWQWJCPSA-N |
| XLogP | 6.88 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.34 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|