C23H38O2Si — CID 91749939
trimethylsilyl (1R,4aR,7R)-7-ethenyl-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,10a-octahydro-2H-phenanthrene-1-carboxylate (PubChem CID 91749939) has the molecular formula C23H38O2Si and a molecular weight of 374.64 g/mol. Its IUPAC name is trimethylsilyl (1R,4aR,7R)-7-ethenyl-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,10a-octahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | trimethylsilyl (1R,4aR,7R)-7-ethenyl-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,10a-octahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 91749939 |
| Molecular Formula | C23H38O2Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | trimethylsilyl (1R,4aR,7R)-7-ethenyl-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,10a-octahydro-2H-phenanthrene-1-carboxylate |
| SMILES | C=C[C@]1(C)CCC2C(C=CC3[C@]2(C)CCC[C@@]3(C)C(=O)O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C23H38O2Si/c1-8-21(2)15-12-18-17(16-21)10-11-19-22(18,3)13-9-14-23(19,4)20(24)25-26(5,6)7/h8,10-11,17-19H,1,9,12-16H2,2-7H3/t17?,18?,19?,21-,22-,23-/m1/s1 |
| InChIKey | UEVGEVZFCZBAQZ-HHYUGBOQSA-N |
| XLogP | 6.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|