C23H40O2Si — CID 91749955
trimethylsilyl (1S,4aS)-1,4a-dimethyl-6-methylidene-5-[(Z)-3-methylpent-2-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 91749955) has the molecular formula C23H40O2Si and a molecular weight of 376.66 g/mol. Its IUPAC name is trimethylsilyl (1S,4aS)-1,4a-dimethyl-6-methylidene-5-[(Z)-3-methylpent-2-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | trimethylsilyl (1S,4aS)-1,4a-dimethyl-6-methylidene-5-[(Z)-3-methylpent-2-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 91749955 |
| Molecular Formula | C23H40O2Si |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | trimethylsilyl (1S,4aS)-1,4a-dimethyl-6-methylidene-5-[(Z)-3-methylpent-2-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CCC2[C@@](C)(CCC[C@]2(C)C(=O)O[Si](C)(C)C)C1C/C=C(/C)CC |
| InChI | InChI=1S/C23H40O2Si/c1-9-17(2)11-13-19-18(3)12-14-20-22(19,4)15-10-16-23(20,5)21(24)25-26(6,7)8/h11,19-20H,3,9-10,12-16H2,1-2,4-8H3/b17-11-/t19?,20?,22-,23-/m0/s1 |
| InChIKey | XDOALGMSEJUNPF-OLIVCDGDSA-N |
| XLogP | 6.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|