About [(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate
[(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate (PubChem CID 91750010) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is [(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate.
Molecular Properties
| Compound Name | [(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate |
| PubChem CID | 91750010 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | [(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate |
| SMILES | CCC(=O)OCC1=CCC(C)(C)C[C@H]1C |
| InChI | InChI=1S/C13H22O2/c1-5-12(14)15-9-11-6-7-13(3,4)8-10(11)2/h6,10H,5,7-9H2,1-4H3/t10-/m1/s1 |
| InChIKey | XOZBCNJUNGIXPL-SNVBAGLBSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate?
The IUPAC name of [(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate (CID 91750010) is [(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate.
What is the SMILES notation for [(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate?
The canonical SMILES for [(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate is CCC(=O)OCC1=CCC(C)(C)C[C@H]1C.
What is the InChIKey of [(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate?
The InChIKey is XOZBCNJUNGIXPL-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H22O2/c1-5-12(14)15-9-11-6-7-13(3,4)8-10(11)2/h6,10H,5,7-9H2,1-4H3/t10-/m1/s1.
What are the key properties of [(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate?
[(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate has a molecular weight of 210.32 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(6R)-4,4,6-trimethylcyclohexen-1-yl]methyl propanoate is sourced from PubChem (CID 91750010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).