About [(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate
[(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate (PubChem CID 91750084) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is [(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate |
| PubChem CID | 91750084 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | [(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1C[C@H]2CC(O)C[C@@H]1N2C |
| InChI | InChI=1S/C12H21NO3/c1-7(2)12(15)16-11-5-8-4-9(14)6-10(11)13(8)3/h7-11,14H,4-6H2,1-3H3/t8-,9?,10+,11?/m1/s1 |
| InChIKey | ZCDAAJWACVZEQQ-VKAADOFISA-N |
| XLogP | 0.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate?
The IUPAC name of [(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate (CID 91750084) is [(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate.
What is the SMILES notation for [(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate?
The canonical SMILES for [(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate is CC(C)C(=O)OC1C[C@H]2CC(O)C[C@@H]1N2C.
What is the InChIKey of [(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate?
The InChIKey is ZCDAAJWACVZEQQ-VKAADOFISA-N. The full InChI is InChI=1S/C12H21NO3/c1-7(2)12(15)16-11-5-8-4-9(14)6-10(11)13(8)3/h7-11,14H,4-6H2,1-3H3/t8-,9?,10+,11?/m1/s1.
What are the key properties of [(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate?
[(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate has a molecular weight of 227.30 g/mol, XLogP of 0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl] 2-methylpropanoate is sourced from PubChem (CID 91750084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).