C18H28ClNO6 — CID 91750127
(1R,4S,6R,7R,10E)-4-(1-chloroethyl)-4,7-dihydroxy-6,7,13-trimethyl-2,9-dioxa-13-azabicyclo[8.5.1]hexadec-10-ene-3,16-dione (PubChem CID 91750127) has the molecular formula C18H28ClNO6 and a molecular weight of 389.88 g/mol. Its IUPAC name is (1R,4S,6R,7R,10E)-4-(1-chloroethyl)-4,7-dihydroxy-6,7,13-trimethyl-2,9-dioxa-13-azabicyclo[8.5.1]hexadec-10-ene-3,16-dione.
| Compound Name | (1R,4S,6R,7R,10E)-4-(1-chloroethyl)-4,7-dihydroxy-6,7,13-trimethyl-2,9-dioxa-13-azabicyclo[8.5.1]hexadec-10-ene-3,16-dione |
|---|---|
| PubChem CID | 91750127 |
| Molecular Formula | C18H28ClNO6 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (1R,4S,6R,7R,10E)-4-(1-chloroethyl)-4,7-dihydroxy-6,7,13-trimethyl-2,9-dioxa-13-azabicyclo[8.5.1]hexadec-10-ene-3,16-dione |
| SMILES | CC(Cl)[C@]1(O)C[C@@H](C)[C@@](C)(O)CO/C2=C/CN(C)CC[C@@H](OC1=O)C2=O |
| InChI | InChI=1S/C18H28ClNO6/c1-11-9-18(24,12(2)19)16(22)26-14-6-8-20(4)7-5-13(15(14)21)25-10-17(11,3)23/h5,11-12,14,23-24H,6-10H2,1-4H3/b13-5+/t11-,12?,14-,17+,18-/m1/s1 |
| InChIKey | QAISIHLCPYMAEI-SRAYKJDUSA-N |
| XLogP | 0.85 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|