C28H60O5Si3 — CID 91750156
methyl (Z)-9,10,18-tris(trimethylsilyloxy)octadec-12-enoate (PubChem CID 91750156) has the molecular formula C28H60O5Si3 and a molecular weight of 561.04 g/mol. Its IUPAC name is methyl (Z)-9,10,18-tris(trimethylsilyloxy)octadec-12-enoate.
| Compound Name | methyl (Z)-9,10,18-tris(trimethylsilyloxy)octadec-12-enoate |
|---|---|
| PubChem CID | 91750156 |
| Molecular Formula | C28H60O5Si3 |
| Molecular Weight | 561.04 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | methyl (Z)-9,10,18-tris(trimethylsilyloxy)octadec-12-enoate |
| SMILES | COC(=O)CCCCCCCC(O[Si](C)(C)C)C(C/C=C\CCCCCO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C28H60O5Si3/c1-30-28(29)24-20-16-13-15-19-23-27(33-36(8,9)10)26(32-35(5,6)7)22-18-14-11-12-17-21-25-31-34(2,3)4/h14,18,26-27H,11-13,15-17,19-25H2,1-10H3/b18-14- |
| InChIKey | WIZYORSJSLAYHG-JXAWBTAJSA-N |
| XLogP | 8.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.04 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|