C30H66O5Si4 — CID 91750157
trimethylsilyl (Z)-9,10,18-tris(trimethylsilyloxy)octadec-12-enoate (PubChem CID 91750157) has the molecular formula C30H66O5Si4 and a molecular weight of 619.20 g/mol. Its IUPAC name is trimethylsilyl (Z)-9,10,18-tris(trimethylsilyloxy)octadec-12-enoate.
| Compound Name | trimethylsilyl (Z)-9,10,18-tris(trimethylsilyloxy)octadec-12-enoate |
|---|---|
| PubChem CID | 91750157 |
| Molecular Formula | C30H66O5Si4 |
| Molecular Weight | 619.20 g/mol |
| Exact Mass | 618.40 |
| IUPAC Name | trimethylsilyl (Z)-9,10,18-tris(trimethylsilyloxy)octadec-12-enoate |
| SMILES | C[Si](C)(C)OCCCCC/C=C\CC(O[Si](C)(C)C)C(CCCCCCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C30H66O5Si4/c1-36(2,3)32-27-23-19-14-13-16-20-24-28(33-37(4,5)6)29(34-38(7,8)9)25-21-17-15-18-22-26-30(31)35-39(10,11)12/h16,20,28-29H,13-15,17-19,21-27H2,1-12H3/b20-16- |
| InChIKey | RICDMDUPMDRSDE-SILNSSARSA-N |
| XLogP | 9.89 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.20 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|