C15H24 — CID 91750200
(5R,6S)-1,5,6-trimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]cyclohexene (PubChem CID 91750200) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is (5R,6S)-1,5,6-trimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]cyclohexene.
| Compound Name | (5R,6S)-1,5,6-trimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]cyclohexene |
|---|---|
| PubChem CID | 91750200 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (5R,6S)-1,5,6-trimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]cyclohexene |
| SMILES | C=C/C(C)=C/C[C@]1(C)C(C)=CCC[C@H]1C |
| InChI | InChI=1S/C15H24/c1-6-12(2)10-11-15(5)13(3)8-7-9-14(15)4/h6,8,10,14H,1,7,9,11H2,2-5H3/b12-10+/t14-,15-/m1/s1 |
| InChIKey | SDGBQFYYFDSSQI-CFXNXBPSSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|