About (3R,5S)-3,5-dimethyldithian-4-one
(3R,5S)-3,5-dimethyldithian-4-one (PubChem CID 91750208) has the molecular formula C6H10OS2
and a molecular weight of 162.28 g/mol. Its IUPAC name is (3R,5S)-3,5-dimethyldithian-4-one.
Molecular Properties
| Compound Name | (3R,5S)-3,5-dimethyldithian-4-one |
| PubChem CID | 91750208 |
| Molecular Formula | C6H10OS2 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | (3R,5S)-3,5-dimethyldithian-4-one |
| SMILES | C[C@@H]1CSS[C@H](C)C1=O |
| InChI | InChI=1S/C6H10OS2/c1-4-3-8-9-5(2)6(4)7/h4-5H,3H2,1-2H3/t4-,5-/m1/s1 |
| InChIKey | SSIXEKSDRWGGOH-RFZPGFLSSA-N |
| XLogP | 1.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze (3R,5S)-3,5-dimethyldithian-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-3,5-dimethyldithian-4-one?
The IUPAC name of (3R,5S)-3,5-dimethyldithian-4-one (CID 91750208) is (3R,5S)-3,5-dimethyldithian-4-one.
What is the SMILES notation for (3R,5S)-3,5-dimethyldithian-4-one?
The canonical SMILES for (3R,5S)-3,5-dimethyldithian-4-one is C[C@@H]1CSS[C@H](C)C1=O.
What is the InChIKey of (3R,5S)-3,5-dimethyldithian-4-one?
The InChIKey is SSIXEKSDRWGGOH-RFZPGFLSSA-N. The full InChI is InChI=1S/C6H10OS2/c1-4-3-8-9-5(2)6(4)7/h4-5H,3H2,1-2H3/t4-,5-/m1/s1.
What are the key properties of (3R,5S)-3,5-dimethyldithian-4-one?
(3R,5S)-3,5-dimethyldithian-4-one has a molecular weight of 162.28 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-3,5-dimethyldithian-4-one is sourced from PubChem (CID 91750208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).