C36H86O11Si8 — CID 91750418
(3R,4R,5S)-1,4,5,6-tetrakis(trimethylsilyloxy)-3-[(2S,3S,4R,5S,6S)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxyhexan-2-one (PubChem CID 91750418) has the molecular formula C36H86O11Si8 and a molecular weight of 919.76 g/mol. Its IUPAC name is (3R,4R,5S)-1,4,5,6-tetrakis(trimethylsilyloxy)-3-[(2S,3S,4R,5S,6S)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxyhexan-2-one.
| Compound Name | (3R,4R,5S)-1,4,5,6-tetrakis(trimethylsilyloxy)-3-[(2S,3S,4R,5S,6S)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxyhexan-2-one |
|---|---|
| PubChem CID | 91750418 |
| Molecular Formula | C36H86O11Si8 |
| Molecular Weight | 919.76 g/mol |
| Exact Mass | 918.43 |
| IUPAC Name | (3R,4R,5S)-1,4,5,6-tetrakis(trimethylsilyloxy)-3-[(2S,3S,4R,5S,6S)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxyhexan-2-one |
| SMILES | C[Si](C)(C)OCC(=O)[C@H](O[C@@H]1O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C36H86O11Si8/c1-48(2,3)38-25-28(37)31(33(45-53(16,17)18)30(43-51(10,11)12)27-40-50(7,8)9)42-36-35(47-55(22,23)24)34(46-54(19,20)21)32(44-52(13,14)15)29(41-36)26-39-49(4,5)6/h29-36H,25-27H2,1-24H3/t29-,30-,31-,32-,33-,34+,35-,36-/m0/s1 |
| InChIKey | SXVUULOQAIHSTD-IFFFQZKNSA-N |
| XLogP | 9.32 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.76 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|