C15H22O — CID 91750424
(2E,5E,9E)-3,7,7,10-tetramethyl-12-oxabicyclo[9.1.0]dodeca-2,5,9-triene (PubChem CID 91750424) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (2E,5E,9E)-3,7,7,10-tetramethyl-12-oxabicyclo[9.1.0]dodeca-2,5,9-triene.
| Compound Name | (2E,5E,9E)-3,7,7,10-tetramethyl-12-oxabicyclo[9.1.0]dodeca-2,5,9-triene |
|---|---|
| PubChem CID | 91750424 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (2E,5E,9E)-3,7,7,10-tetramethyl-12-oxabicyclo[9.1.0]dodeca-2,5,9-triene |
| SMILES | C/C1=C\C2OC2/C(C)=C/CC(C)(C)/C=C/C1 |
| InChI | InChI=1S/C15H22O/c1-11-6-5-8-15(3,4)9-7-12(2)14-13(10-11)16-14/h5,7-8,10,13-14H,6,9H2,1-4H3/b8-5+,11-10+,12-7+ |
| InChIKey | CURDSHVMYFYNIX-GQRUBBQQSA-N |
| XLogP | 4.02 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|