C17H24O6 — CID 91750632
(2Z,4E)-5-[(1R,8S)-3-acetyloxy-8-hydroxy-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 91750632) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is (2Z,4E)-5-[(1R,8S)-3-acetyloxy-8-hydroxy-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-[(1R,8S)-3-acetyloxy-8-hydroxy-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 91750632 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (2Z,4E)-5-[(1R,8S)-3-acetyloxy-8-hydroxy-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(=O)OC1CC2(C)OC[C@@](C)(C1)[C@@]2(O)/C=C/C(C)=C\C(=O)O |
| InChI | InChI=1S/C17H24O6/c1-11(7-14(19)20)5-6-17(21)15(3)8-13(23-12(2)18)9-16(17,4)22-10-15/h5-7,13,21H,8-10H2,1-4H3,(H,19,20)/b6-5+,11-7-/t13?,15-,16?,17+/m1/s1 |
| InChIKey | QYOPWKHLKFNPNL-OKYLYIEVSA-N |
| XLogP | 1.83 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|