About 6-(2,5-dimethylheptyl)-3-methylpyran-2-one
6-(2,5-dimethylheptyl)-3-methylpyran-2-one (PubChem CID 91750804) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is 6-(2,5-dimethylheptyl)-3-methylpyran-2-one.
Molecular Properties
| Compound Name | 6-(2,5-dimethylheptyl)-3-methylpyran-2-one |
| PubChem CID | 91750804 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 6-(2,5-dimethylheptyl)-3-methylpyran-2-one |
| SMILES | CCC(C)CCC(C)Cc1ccc(C)c(=O)o1 |
| InChI | InChI=1S/C15H24O2/c1-5-11(2)6-7-12(3)10-14-9-8-13(4)15(16)17-14/h8-9,11-12H,5-7,10H2,1-4H3 |
| InChIKey | XBJHSMUZOJJYBO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2,5-dimethylheptyl)-3-methylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dimethylheptyl)-3-methylpyran-2-one?
The IUPAC name of 6-(2,5-dimethylheptyl)-3-methylpyran-2-one (CID 91750804) is 6-(2,5-dimethylheptyl)-3-methylpyran-2-one.
What is the SMILES notation for 6-(2,5-dimethylheptyl)-3-methylpyran-2-one?
The canonical SMILES for 6-(2,5-dimethylheptyl)-3-methylpyran-2-one is CCC(C)CCC(C)Cc1ccc(C)c(=O)o1.
What is the InChIKey of 6-(2,5-dimethylheptyl)-3-methylpyran-2-one?
The InChIKey is XBJHSMUZOJJYBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-5-11(2)6-7-12(3)10-14-9-8-13(4)15(16)17-14/h8-9,11-12H,5-7,10H2,1-4H3.
What are the key properties of 6-(2,5-dimethylheptyl)-3-methylpyran-2-one?
6-(2,5-dimethylheptyl)-3-methylpyran-2-one has a molecular weight of 236.35 g/mol, XLogP of 3.95, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dimethylheptyl)-3-methylpyran-2-one is sourced from PubChem (CID 91750804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).