C9H18O2S — CID 91750809
2,4,6-triethyl-1,3,5-dioxathiane (PubChem CID 91750809) has the molecular formula C9H18O2S and a molecular weight of 190.31 g/mol. Its IUPAC name is 2,4,6-triethyl-1,3,5-dioxathiane.
| Compound Name | 2,4,6-triethyl-1,3,5-dioxathiane |
|---|---|
| PubChem CID | 91750809 |
| Molecular Formula | C9H18O2S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2,4,6-triethyl-1,3,5-dioxathiane |
| SMILES | CCC1OC(CC)SC(CC)O1 |
| InChI | InChI=1S/C9H18O2S/c1-4-7-10-8(5-2)12-9(6-3)11-7/h7-9H,4-6H2,1-3H3 |
| InChIKey | SVNXDVGQOSCMJR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |