About 3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole
3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole (PubChem CID 91751205) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is 3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | 3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole |
| PubChem CID | 91751205 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole |
| SMILES | CCC1=NNC(C)C1 |
| InChI | InChI=1S/C6H12N2/c1-3-6-4-5(2)7-8-6/h5,7H,3-4H2,1-2H3 |
| InChIKey | JGTXZZJCAVKRPL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole?
The IUPAC name of 3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole (CID 91751205) is 3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole.
What is the SMILES notation for 3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole?
The canonical SMILES for 3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole is CCC1=NNC(C)C1.
What is the InChIKey of 3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole?
The InChIKey is JGTXZZJCAVKRPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-3-6-4-5(2)7-8-6/h5,7H,3-4H2,1-2H3.
What are the key properties of 3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole?
3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole has a molecular weight of 112.18 g/mol, XLogP of 1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-methyl-4,5-dihydro-1H-pyrazole is sourced from PubChem (CID 91751205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).