About (3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate
(3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate (PubChem CID 91751330) has the molecular formula C26H52O5Si
and a molecular weight of 472.78 g/mol. Its IUPAC name is (3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate.
Molecular Properties
| Compound Name | (3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate |
| PubChem CID | 91751330 |
| Molecular Formula | C26H52O5Si |
| Molecular Weight | 472.78 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | (3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate |
| SMILES | CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C26H52O5Si/c1-6-8-10-12-14-16-18-20-25(27)29-22-24(31-32(3,4)5)23-30-26(28)21-19-17-15-13-11-9-7-2/h24H,6-23H2,1-5H3 |
| InChIKey | NMHAWAZVGSYQLU-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.78 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate?
The IUPAC name of (3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate (CID 91751330) is (3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate.
What is the SMILES notation for (3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate?
The canonical SMILES for (3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate is CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)O[Si](C)(C)C.
What is the InChIKey of (3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate?
The InChIKey is NMHAWAZVGSYQLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H52O5Si/c1-6-8-10-12-14-16-18-20-25(27)29-22-24(31-32(3,4)5)23-30-26(28)21-19-17-15-13-11-9-7-2/h24H,6-23H2,1-5H3.
What are the key properties of (3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate?
(3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate has a molecular weight of 472.78 g/mol, XLogP of 7.57, 22 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-decanoyloxy-2-trimethylsilyloxypropyl) decanoate is sourced from PubChem (CID 91751330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).