C12H20O2 — CID 91751454
(3R,4Z)-3-hydroxy-5,9-dimethyldeca-4,8-dien-2-one (PubChem CID 91751454) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (3R,4Z)-3-hydroxy-5,9-dimethyldeca-4,8-dien-2-one.
| Compound Name | (3R,4Z)-3-hydroxy-5,9-dimethyldeca-4,8-dien-2-one |
|---|---|
| PubChem CID | 91751454 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (3R,4Z)-3-hydroxy-5,9-dimethyldeca-4,8-dien-2-one |
| SMILES | CC(=O)[C@H](O)/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C12H20O2/c1-9(2)6-5-7-10(3)8-12(14)11(4)13/h6,8,12,14H,5,7H2,1-4H3/b10-8-/t12-/m1/s1 |
| InChIKey | DPGJGJBHBQMSDM-VPUINMBXSA-N |
| XLogP | 2.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|