C20H23F3O2 — CID 91751484
[(8R,9S,13S,14S,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2,2,2-trifluoroacetate (PubChem CID 91751484) has the molecular formula C20H23F3O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(8R,9S,13S,14S,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91751484 |
| Molecular Formula | C20H23F3O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | [(8R,9S,13S,14S,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2,2,2-trifluoroacetate |
| SMILES | C[C@]12CC[C@@H]3c4ccccc4CC[C@H]3[C@@H]1CC[C@H]2OC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H23F3O2/c1-19-11-10-14-13-5-3-2-4-12(13)6-7-15(14)16(19)8-9-17(19)25-18(24)20(21,22)23/h2-5,14-17H,6-11H2,1H3/t14-,15-,16+,17-,19+/m1/s1 |
| InChIKey | HOAPZVGQTWGAQC-ILYVXUQDSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |