C27H53BO6Si2 — CID 91751604
trimethylsilyl (Z,8S,9S)-9-hydroxy-8-[(4S,7S)-2-methyl-7-pentyl-4,7-dihydro-1,3,2-dioxaborepin-4-yl]-11-trimethylsilyloxyundec-5-enoate (PubChem CID 91751604) has the molecular formula C27H53BO6Si2 and a molecular weight of 540.70 g/mol. Its IUPAC name is trimethylsilyl (Z,8S,9S)-9-hydroxy-8-[(4S,7S)-2-methyl-7-pentyl-4,7-dihydro-1,3,2-dioxaborepin-4-yl]-11-trimethylsilyloxyundec-5-enoate.
| Compound Name | trimethylsilyl (Z,8S,9S)-9-hydroxy-8-[(4S,7S)-2-methyl-7-pentyl-4,7-dihydro-1,3,2-dioxaborepin-4-yl]-11-trimethylsilyloxyundec-5-enoate |
|---|---|
| PubChem CID | 91751604 |
| Molecular Formula | C27H53BO6Si2 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | trimethylsilyl (Z,8S,9S)-9-hydroxy-8-[(4S,7S)-2-methyl-7-pentyl-4,7-dihydro-1,3,2-dioxaborepin-4-yl]-11-trimethylsilyloxyundec-5-enoate |
| SMILES | CCCCC[C@H]1C=C[C@@H]([C@@H](C/C=C\CCCC(=O)O[Si](C)(C)C)[C@@H](O)CCO[Si](C)(C)C)OB(C)O1 |
| InChI | InChI=1S/C27H53BO6Si2/c1-9-10-13-16-23-19-20-26(33-28(2)32-23)24(25(29)21-22-31-35(3,4)5)17-14-11-12-15-18-27(30)34-36(6,7)8/h11,14,19-20,23-26,29H,9-10,12-13,15-18,21-22H2,1-8H3/b14-11-/t23-,24-,25-,26-/m0/s1 |
| InChIKey | QNKWIDWCPGWMLM-PHOQXVHTSA-N |
| XLogP | 6.74 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|