C38H76O6Si3 — CID 91751606
[tert-butyl(dimethyl)silyl] (Z)-7-[(2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-6-hydroxyoxan-3-yl]hept-5-enoate (PubChem CID 91751606) has the molecular formula C38H76O6Si3 and a molecular weight of 713.28 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (Z)-7-[(2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-6-hydroxyoxan-3-yl]hept-5-enoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (Z)-7-[(2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-6-hydroxyoxan-3-yl]hept-5-enoate |
|---|---|
| PubChem CID | 91751606 |
| Molecular Formula | C38H76O6Si3 |
| Molecular Weight | 713.28 g/mol |
| Exact Mass | 712.49 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (Z)-7-[(2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-6-hydroxyoxan-3-yl]hept-5-enoate |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1OC(O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H76O6Si3/c1-17-18-21-24-30(42-45(11,12)36(2,3)4)27-28-32-31(33(29-35(40)41-32)43-46(13,14)37(5,6)7)25-22-19-20-23-26-34(39)44-47(15,16)38(8,9)10/h19,22,27-28,30-33,35,40H,17-18,20-21,23-26,29H2,1-16H3/b22-19-,28-27+/t30-,31+,32+,33-,35?/m0/s1 |
| InChIKey | XQRPEYGADDUWES-HAMJELLFSA-N |
| XLogP | 11.29 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.28 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|