C29H58O6Si3 — CID 91751607
trimethylsilyl (Z)-7-[(2R,3R,4S)-6-hydroxy-4-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]oxan-3-yl]hept-5-enoate (PubChem CID 91751607) has the molecular formula C29H58O6Si3 and a molecular weight of 587.04 g/mol. Its IUPAC name is trimethylsilyl (Z)-7-[(2R,3R,4S)-6-hydroxy-4-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]oxan-3-yl]hept-5-enoate.
| Compound Name | trimethylsilyl (Z)-7-[(2R,3R,4S)-6-hydroxy-4-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]oxan-3-yl]hept-5-enoate |
|---|---|
| PubChem CID | 91751607 |
| Molecular Formula | C29H58O6Si3 |
| Molecular Weight | 587.04 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | trimethylsilyl (Z)-7-[(2R,3R,4S)-6-hydroxy-4-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]oxan-3-yl]hept-5-enoate |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1OC(O)C[C@H](O[Si](C)(C)C)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C29H58O6Si3/c1-11-12-15-18-24(33-36(2,3)4)21-22-26-25(27(23-29(31)32-26)34-37(5,6)7)19-16-13-14-17-20-28(30)35-38(8,9)10/h13,16,21-22,24-27,29,31H,11-12,14-15,17-20,23H2,1-10H3/b16-13-,22-21+/t24-,25+,26+,27-,29?/m0/s1 |
| InChIKey | IPOAFSHHUOPOBE-QSARZFJDSA-N |
| XLogP | 7.78 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.04 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|